logo
Home  > Methyl 4-(4-fluorophenyl)nicotinate

AX49288

110307-23-8 | Methyl 4-(4-fluorophenyl)nicotinate

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AX49288
Chemical Name: Methyl 4-(4-fluorophenyl)nicotinate
CAS Number: 110307-23-8
Molecular Formula: C13H10FNO2
Molecular Weight: 231.2224
MDL Number: MFCD27996651
SMILES: COC(=O)c1cnccc1c1ccc(cc1)F

 

Upstream Synthesis Route
  • Methyl 4-(4-fluorophenyl)nicotinate is a versatile compound commonly used in chemical synthesis for its unique properties and applications. One of the key uses of this compound is as a building block in the synthesis of novel pharmaceutical compounds. Its specific structure allows for strategic modifications to be made, leading to the development of new drug candidates with enhanced pharmacological properties. Additionally, Methyl 4-(4-fluorophenyl)nicotinate can serve as a precursor in the preparation of various heterocyclic compounds, making it valuable in the creation of complex organic molecules. Its role in chemical synthesis extends to the creation of agrochemicals, materials science, and other fields where precise and controlled reactions are essential for product development. Overall, the application of Methyl 4-(4-fluorophenyl)nicotinate in chemical synthesis highlights its importance as a key intermediate in the production of diverse compounds with potential therapeutic or industrial significance.
FEATURED PRODUCTS