logo
Home  > 10-trans-Atorvastatin Acetonide tert-Butyl Ester

AE14086

1105067-90-0 | 10-trans-Atorvastatin Acetonide tert-Butyl Ester

Packsize Purity Availability Price Discounted Price    Quantity
10mg 99% 2 weeks $890.00 $623.00 -   +
25mg 99% 2 weeks $1,515.00 $1,060.00 -   +
100mg 99% 2 weeks $2,515.00 $1,760.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE14086
Chemical Name: 10-trans-Atorvastatin Acetonide tert-Butyl Ester
CAS Number: 1105067-90-0
Molecular Formula: C40H47FN2O5
Molecular Weight: 654.8100
SMILES: O=C(OC(C)(C)C)C[C@@H]1C[C@@H](CCn2c(C(C)C)c(c(c2c2ccc(cc2)F)c2ccccc2)C(=O)Nc2ccccc2)OC(O1)(C)C

 

Upstream Synthesis Route 
  • The compound 1,​1-​Dimethylethyl (4S,​6R)​-​6-​[2-​[2-​(4-​fluorophenyl)​-​5-​(1-​methylethyl)​-​3-​phenyl-​4-​[(phenylamino)​carbonyl]​-​1H-​pyrrol-​1-​yl]​ethyl]​-​2,​2-​dimethyl-​1,​3-​dioxane-​4-​acetate is a key reagent used in chemical synthesis. This compound plays a crucial role in organic chemistry reactions due to its unique structural features. It can serve as a versatile building block in the creation of complex organic molecules with specific stereochemical configurations. Its presence can significantly influence the outcome and efficiency of various synthetic processes, making it an essential tool for chemists working in the field of drug discovery, material science, and other areas requiring precise chemical synthesis.
FEATURED PRODUCTS