AD78097
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD78097 |
Chemical Name: | (4R,6R)-2,2-DIMETHYL-6-[2-[2-(1-METHYLETHYL)-4,5-DIPHENYL-3-[(PHENYLAMINO)CARBONYL]-1H-PYRROL-1-YL]ETHYL]-1,3-DIOXANE-4-ACETIC ACID TERT-BUTYL ESTER |
CAS Number: | 1105067-91-1 |
Molecular Formula: | C40H48N2O5 |
Molecular Weight: | 636.8195 |
MDL Number: | MFCD23160665 |
SMILES: | O=C(OC(C)(C)C)C[C@H]1C[C@@H](CCn2c(C(C)C)c(c(c2c2ccccc2)c2ccccc2)C(=O)Nc2ccccc2)OC(O1)(C)C |
The compound ($name$) is commonly employed as a chiral building block in chemical synthesis due to its unique stereochemical arrangement. Specifically, its asymmetric (4R,6R) configuration is crucial in facilitating the creation of complex organic molecules with desired stereochemistry. By incorporating ($name$) into synthetic pathways, chemists can efficiently access a wide range of structurally diverse compounds for various applications in pharmaceuticals, agrochemicals, materials science, and more. Its versatility in enabling the controlled construction of molecular frameworks makes ($name$) a valuable tool in the development of novel chemical entities with tailored properties and functionalities.