AV81983
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 3 weeks | $747.00 | $523.00 | - + | |
5mg | 95% | 3 weeks | $843.00 | $590.00 | - + | |
10mg | 95% | 3 weeks | $912.00 | $639.00 | - + | |
25mg | 95% | 3 weeks | $1,160.00 | $812.00 | - + | |
50mg | 95% | 3 weeks | $1,677.00 | $1,174.00 | - + | |
100mg | 95% | 3 weeks | $2,365.00 | $1,656.00 | - + | |
1g | 95% | 3 weeks | $2,925.00 | $2,048.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV81983 |
Chemical Name: | 6-CYCLOPROPYL-1-(4-METHYLPHENYL)-1,5-DIHYDRO-4H-PYRAZOLO[3,4-D]PYRIMIDIN-+ |
CAS Number: | 1105198-46-6 |
Molecular Formula: | C15H14N4O |
Molecular Weight: | 266.2979 |
MDL Number: | MFCD11986602 |
SMILES: | Cc1ccc(cc1)n1ncc2c1nc([nH]c2=O)C1CC1 |
6-Cyclopropyl-1-(4-methylphenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is a versatile compound commonly employed in chemical synthesis. This unique molecule serves as a key building block in the development of pharmaceuticals, agrochemicals, and materials science. Its cyclopropyl ring provides structural rigidity, enhancing its utility as a molecular scaffold in drug discovery. The presence of the 4-methylphenyl group offers additional functionality for tailoring the compound's physicochemical properties. In organic synthesis, this compound participates in various transformations, including heterocyclic ring closure reactions, functional group manipulations, and diversity-oriented synthesis strategies. The strategic incorporation of 6-cyclopropyl-1-(4-methylphenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one in synthetic routes enables the efficient production of complex molecules with potential applications in diverse fields.