logo
Home  > Chemistry  > Organometallic Reagents  > Organoboron  > 4-(2-methoxyphenyl)phenylboronic acid

AE25169

1107041-07-5 | 4-(2-methoxyphenyl)phenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $712.00 $498.00 -   +
5g 98% in stock $2,499.00 $1,749.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE25169
Chemical Name: 4-(2-methoxyphenyl)phenylboronic acid
CAS Number: 1107041-07-5
Molecular Formula: C13H13BO3
Molecular Weight: 228.0515
MDL Number: MFCD08701729
SMILES: COc1ccccc1c1ccc(cc1)B(O)O

 

Computed Properties
Complexity: 227  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 3  

 

 

Upstream Synthesis Route
  • 4-(2-Methoxyphenyl)phenylboronic acid is a valuable organic compound that finds important applications in various chemical synthesis processes. As a boronic acid derivative, it serves as a versatile building block in organic chemistry for the construction of complex molecules. Its unique structure and reactivity make it a useful reagent in Suzuki-Miyaura cross-coupling reactions, where it can be used to form carbon-carbon bonds efficiently. This compound also plays a crucial role in the preparation of biologically active molecules, pharmaceuticals, and advanced materials. Additionally, 4-(2-Methoxyphenyl)phenylboronic acid is an important tool in medicinal chemistry for the design and synthesis of novel drug candidates. Its compatibility with a wide range of functional groups and its ability to undergo various transformations make it a key component in the arsenal of synthetic chemists.
FEATURED PRODUCTS