logo
Home  > Dimethy-4-fluorophthalate

AE12544

110706-50-8 | Dimethy-4-fluorophthalate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $39.00 $28.00 -   +
1g 95% in stock $119.00 $84.00 -   +
5g 95% in stock $372.00 $260.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE12544
Chemical Name: Dimethy-4-fluorophthalate
CAS Number: 110706-50-8
Molecular Formula: C10H9FO4
Molecular Weight: 212.17446320000005
MDL Number: MFCD09263469
SMILES: COC(=O)c1cc(F)ccc1C(=O)OC

 

Upstream Synthesis Route 
  • Dimethyl 4-fluorophthalate is a versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. In the realm of pharmaceuticals, this compound is employed in the synthesis of potential drug candidates due to its unique molecular structure and reactivity. Additionally, in the field of agrochemicals, Dimethyl 4-fluorophthalate is utilized for the development of crop protection agents and pesticides. Its ability to undergo various chemical transformations makes it an essential component in the production of specialty chemicals and advanced materials. Ultimately, Dimethyl 4-fluorophthalate plays a crucial role in the synthesis of diverse chemical products with important applications in multiple industries.
FEATURED PRODUCTS