AD77398
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $20.00 | $14.00 | - + | |
250mg | 95% | in stock | $29.00 | $20.00 | - + | |
1g | 95% | in stock | $70.00 | $49.00 | - + | |
5g | 95% | in stock | $207.00 | $145.00 | - + | |
25g | 95% | in stock | $616.00 | $431.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD77398 |
Chemical Name: | N6-BENZOYL-5'-(DIMETHOXYTRITYL)-2'-O-METHYLADENOSINE |
CAS Number: | 110764-72-2 |
Molecular Formula: | C39H37N5O7 |
Molecular Weight: | 687.7404 |
MDL Number: | MFCD08704196 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H]([C@@H]([C@@H]1O)OC)n1cnc2c1ncnc2NC(=O)c1ccccc1 |
The compound N-(9-((2R,3R,4R,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxy-3-methoxytetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide is a versatile reagent commonly used in chemical synthesis. Its unique structure allows for precise manipulation of molecular architecture and selective functional group transformations, making it an essential tool for synthetic chemists. In particular, this compound is employed in the construction of complex organic molecules and pharmaceutical intermediates due to its ability to facilitate key bond-forming reactions and stereochemical control. Its application in chemical synthesis enables efficient access to diverse molecular frameworks with high regio- and stereoselectivity, contributing to the advancement of synthetic methodologies and the development of novel compounds for various applications.