AE17924
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $29.00 | $20.00 | - + | |
5g | 98% | in stock | $85.00 | $59.00 | - + | |
10g | 98% | in stock | $160.00 | $112.00 | - + | |
25g | 95% | in stock | $380.00 | $266.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE17924 |
Chemical Name: | 5'-O-(4,4'-Dimethoxytrityl)-2'-O-methyluridine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite |
CAS Number: | 110764-79-9 |
Molecular Formula: | C40H49N4O9P |
Molecular Weight: | 760.8122 |
MDL Number: | MFCD00792626 |
SMILES: | N#CCCOP(N(C(C)C)C(C)C)O[C@@H]1[C@@H](COC(c2ccc(cc2)OC)(c2ccc(cc2)OC)c2ccccc2)O[C@H]([C@@H]1OC)n1ccc(=O)[nH]c1=O |
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-methyl-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] is commonly utilized in chemical synthesis as a key building block for oligonucleotide synthesis. This compound serves as a phosphoramidite derivative of uridine, enabling efficient coupling with other nucleotide derivatives during the solid-phase synthesis of oligonucleotides. Its unique structure allows for precise and controlled incorporation of uridine into the growing nucleic acid chain, making it an essential reagent in the production of custom DNA and RNA sequences for various research and biotechnological applications.