AE08135
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | in stock | $83.00 | $58.00 | - + | |
5g | 99% | in stock | $160.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08135 |
Chemical Name: | ROXATIDINE OXALATE |
CAS Number: | 110925-92-3 |
Molecular Formula: | C36H54N4O10 |
Molecular Weight: | 702.8347600000004 |
MDL Number: | MFCD08061835 |
SMILES: | OC(=O)C(=O)O.OCC(=O)NCCCOc1cccc(c1)CN1CCCCC1.OCC(=O)NCCCOc1cccc(c1)CN1CCCCC1 |
Roxatidine hemioxalate, commonly used in chemical synthesis, is a versatile compound that plays a crucial role in various reactions and processes in the field of chemistry. With its unique properties and characteristics, Roxatidine hemioxalate serves as a key reagent in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its ability to undergo controlled reactions with various compounds makes it a preferred choice for researchers and chemists working on complex organic synthesis projects. Additionally, its stability and compatibility with different solvents and reaction conditions make it a reliable component in the synthesis of novel molecules and materials. Overall, Roxatidine hemioxalate is an indispensable tool in modern chemical synthesis, facilitating the creation of innovative compounds and advancements in the field of chemistry.