110956-75-7 | Pentoxazone

Packsize	Purity	Availability	Price	Discounted Price
20mg		2 weeks	$960.00	$672.00

Description

• Catalog Number: AE08801
• Chemical Name: Pentoxazone
• CAS Number: 110956-75-7
• Molecular Formula: C17H17ClFNO4
• Molecular Weight: 353.7726
• MDL Number: MFCD03427480
• SMILES: CC(=C1OC(=O)N(C1=O)c1cc(OC2CCCC2)c(cc1F)Cl)C

Upstream Synthesis Route

Pentoxazone, a versatile chemical compound, plays a crucial role in chemical synthesis, particularly in the field of medicinal chemistry. With its unique structure and properties, Pentoxazone is utilized as a key building block in the synthesis of various pharmaceutical compounds, including potential drugs for treating various medical conditions.In chemical synthesis, Pentoxazone serves as a valuable intermediate in the creation of more complex molecules. Its strategic incorporation can lead to the formation of novel drug candidates with improved therapeutic properties and enhanced biological activities. By enabling the synthesis of diverse chemical structures, Pentoxazone facilitates the development of innovative pharmaceuticals that target specific molecular pathways or biological targets.Moreover, Pentoxazone's compatibility with different synthetic methodologies and functional group transformations makes it a versatile tool for chemists engaged in drug discovery and development. Its presence in the synthetic route ensures efficient and controlled assembly of molecular frameworks, contributing to the overall success of the synthesis process.Overall, the application of Pentoxazone in chemical synthesis underscores its significance as a valuable component in the pharmaceutical industry, fostering the creation of new drugs and therapeutic agents with the potential to address unmet medical needs and improve patient outcomes.