logo
Home  > 3-Deacetylsalannin

AE17174

1110-56-1 | 3-Deacetylsalannin

Packsize Purity Availability Price Discounted Price    Quantity
5mg 97% 2 weeks $1,027.00 $719.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE17174
Chemical Name: 3-Deacetylsalannin
CAS Number: 1110-56-1
Molecular Formula: C32H42O8
Molecular Weight: 554.6711
MDL Number: MFCD03427689
SMILES: COC(=O)C[C@@H]1[C@@]2(C)[C@@H](OC(=O)/C(=C/C)/C)C[C@H]([C@@]3([C@@H]2[C@H]([C@@H]2[C@@]1(C)C1=C(C)[C@@H](C[C@H]1O2)c1ccoc1)OC3)C)O

 

Upstream Synthesis Route 
  • Deacetylsalannin is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as a key building block in the production of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, Deacetylsalannin acts as a precursor in the creation of more complex structures through various reactions such as acylation, alkylation, and condensation. Its reactivity and compatibility with different functional groups make it a valuable tool for chemists in designing and creating novel molecules for various applications. Moreover, the ability of Deacetylsalannin to undergo multiple transformations while retaining its core structure makes it a crucial component in the development of new and innovative chemical entities.
FEATURED PRODUCTS