AE24998
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | 2 weeks | $4,234.00 | $2,964.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE24998 |
Chemical Name: | (S,E)-3-(2,6-dichloro-4-((4-(3-(1-(hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-yl)carbamoyl)phenyl)-2-methylacrylic acid |
CAS Number: | 1110768-00-7 |
Molecular Formula: | C31H36Cl2N2O5S |
Molecular Weight: | 619.5989 |
MDL Number: | MFCD28502075 |
SMILES: | CCCCCCO[C@H](c1cccc(c1OC)c1csc(n1)NC(=O)c1cc(Cl)c(c(c1)Cl)/C=C(/C(=O)OCC)\C)C |
The compound Ethyl (2E)-3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-2-propenoate is a versatile building block in chemical synthesis. It can be utilized as a key intermediate in the production of complex organic molecules, particularly those with pharmaceutical or agrochemical applications.This compound's unique structure, combining functional groups such as thiazole, amine, ester, and chloro substituents, allows for numerous synthetic pathways and derivatization strategies. Its presence in a synthetic scheme can enable the introduction of specific pharmacophores or structural motifs crucial for the desired biological activity of the final compound.In chemical synthesis, Ethyl (2E)-3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-2-propenoate serves as a valuable tool for manipulating molecular structures, facilitating the creation of novel compounds with enhanced properties or functions. Its participation in multi-step syntheses highlights its importance as a strategic component in the construction of diverse organic molecules of medicinal or agricultural significance.