AB66007
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $48.00 | $34.00 | - + | |
250mg | 98% | in stock | $86.00 | $60.00 | - + | |
1g | 98% | in stock | $231.00 | $162.00 | - + | |
5g | 98% | in stock | $806.00 | $564.00 | - + | |
25g | 98% | in stock | $3,089.00 | $2,162.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66007 |
Chemical Name: | 4-(Methoxycarbonyl)furan-2-boronic acid, pinacol ester |
CAS Number: | 1111096-29-7 |
Molecular Formula: | C12H17BO5 |
Molecular Weight: | 252.0714 |
MDL Number: | MFCD12407248 |
SMILES: | COC(=O)c1coc(c1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 325 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 3 |
The Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate is a versatile compound commonly utilized in chemical synthesis. This compound serves as a key building block in the preparation of various organic molecules due to its unique reactivity and structural features. In chemical synthesis, Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate acts as a valuable substrate for Suzuki-Miyaura cross-coupling reactions, enabling the formation of complex carbon-carbon bonds with high efficiency. Additionally, this compound can undergo functional group transformations, making it an essential component in the creation of diverse chemical structures. Its significance lies in its ability to facilitate the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals with tailored properties for various industrial applications.