AE31935
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $460.00 | $322.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE31935 |
Chemical Name: | tert-Butyl 3-amino-3-(2-ethoxy-2-oxoethyl)azetidine-1-carboxylate |
CAS Number: | 1111202-76-6 |
Molecular Formula: | C12H22N2O4 |
Molecular Weight: | 258.3141 |
MDL Number: | MFCD18375085 |
SMILES: | CCOC(=O)CC1(N)CN(C1)C(=O)OC(C)(C)C |
Complexity: | 330 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.6 |
The tert-butyl 3-amino-3-(2-ethoxy-2-oxoethyl)azetidine-1-carboxylate is a versatile compound used in chemical synthesis, particularly in the field of medicinal chemistry and drug development. This compound serves as a key building block for the synthesis of various bioactive molecules and pharmaceuticals.Due to its unique structure and functional groups, tert-butyl 3-amino-3-(2-ethoxy-2-oxoethyl)azetidine-1-carboxylate can be easily modified and transformed into a wide range of derivatives. These derivatives can exhibit different pharmacological properties, making them valuable tools for drug discovery and development.In chemical synthesis, this compound can be utilized as a precursor in the construction of heterocyclic compounds and peptide mimetics. Its azetidine ring offers conformational constraints that can enhance the biological activity and selectivity of the resulting compounds. Additionally, the ethoxy and carbonyl groups provide sites for further derivatization, allowing for the introduction of additional functional groups to fine-tune the properties of the final compounds.Overall, tert-butyl 3-amino-3-(2-ethoxy-2-oxoethyl)azetidine-1-carboxylate plays a crucial role in facilitating the creation of novel drug candidates and chemical probes with potential therapeutic applications. Its versatility and synthetic accessibility make it a valuable asset in the toolbox of organic chemists working in the field of pharmaceutical research.