AD64858
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $25.00 | $17.00 | - + | |
25g | 95% | in stock | $65.00 | $45.00 | - + | |
100g | 95% | in stock | $215.00 | $150.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD64858 |
Chemical Name: | Rose Bengal |
CAS Number: | 11121-48-5 |
Molecular Formula: | C20H2Cl4I4Na2O5 |
Molecular Weight: | 1017.6363 |
MDL Number: | MFCD00151169 |
SMILES: | Clc1c(Cl)c(Cl)c(c(c1Cl)C(=O)[O-])c1c2-c(oc3c1cc(I)c(c3I)[O-])c(c(=O)c(c2)I)I.[Na+].[Na+] |
Rose Bengal is a versatile and widely utilized dye in chemical synthesis due to its unique properties and reactivity. Known for its vibrant red color and water solubility, Rose Bengal serves as a powerful photochemical reagent in various synthetic applications. Primarily, it is employed as a sensitizer in photooxidation reactions, where it facilitates the generation of singlet oxygen upon illumination.Additionally, Rose Bengal can act as a catalyst in organic transformations, promoting the formation of new carbon-carbon and carbon-heteroatom bonds. Its ability to participate in both oxidation and reduction processes makes it a valuable tool in the synthesis of complex organic molecules. Furthermore, Rose Bengal has found utility in the preparation of various pharmaceutical intermediates and fine chemicals, demonstrating its significance in modern chemical research and development.