AB75904
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $14.00 | $10.00 | - + | |
1g | 98% | in stock | $42.00 | $30.00 | - + | |
5g | 98% | in stock | $208.00 | $146.00 | - + | |
10g | 98% | in stock | $354.00 | $248.00 | - + | |
25g | 98% | in stock | $708.00 | $496.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75904 |
Chemical Name: | Methyl 4-methoxy-2-indolecarboxylate |
CAS Number: | 111258-23-2 |
Molecular Formula: | C11H11NO3 |
Molecular Weight: | 205.20994000000002 |
MDL Number: | MFCD00134300 |
SMILES: | COC(=O)c1[nH]c2c(c1)c(OC)ccc2 |
Complexity: | 244 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.4 |
Methyl 4-methoxy-1H-indole-2-carboxylate is a key reagent in organic synthesis, particularly in the field of pharmaceutical chemistry. Its ability to undergo various chemical reactions makes it a valuable building block for the synthesis of complex molecules with biological activity. One common application of this compound is in the preparation of indole-based drugs and natural products. By strategically modifying the indole core using Methyl 4-methoxy-1H-indole-2-carboxylate as a starting material, chemists are able to create novel compounds with potential therapeutic uses. Additionally, this compound can be used as a precursor for the synthesis of fluorescent molecules, dyes, and other functional materials. Its versatile nature and role in chemical transformations position Methyl 4-methoxy-1H-indole-2-carboxylate as a valuable tool in the arsenal of synthetic chemists.