AB76891
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | 2 weeks | $347.00 | $243.00 | - + | |
100mg | 95% | 2 weeks | $1,007.00 | $705.00 | - + | |
250mg | 95% | 2 weeks | $1,831.00 | $1,282.00 | - + | |
1g | 95% | 2 weeks | $3,470.00 | $2,429.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB76891 |
Chemical Name: | N-(6-(6-Chloro-5-(4-fluorophenylsulfonamido)pyridin-3-yl)benzo[d]thiazol-2-yl)acetamide |
CAS Number: | 1112980-86-5 |
Molecular Formula: | C20H14ClFN4O3S2 |
Molecular Weight: | 476.9316 |
MDL Number: | MFCD19443166 |
SMILES: | CC(=O)Nc1nc2c(s1)cc(cc2)c1cnc(c(c1)NS(=O)(=O)c1ccc(cc1)F)Cl |
Complexity: | 747 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 4 |
Bioorganic & medicinal chemistry letters 20120901
Journal of medicinal chemistry 20110728
Journal of medicinal chemistry 20110714
Journal of medicinal chemistry 20110324