logo
Home  > 1-Benzofuro[3,2-d]pyrimidin-4-yl-N-phenyl-3-piperidinecarboxamide

BO35449

1113117-64-8 | 1-Benzofuro[3,2-d]pyrimidin-4-yl-N-phenyl-3-piperidinecarboxamide

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: BO35449
Chemical Name: 1-Benzofuro[3,2-d]pyrimidin-4-yl-N-phenyl-3-piperidinecarboxamide
CAS Number: 1113117-64-8
Molecular Formula: C22H20N4O2
Molecular Weight: 372.4198
SMILES: O=C(C1CCCN(C1)c1ncnc2c1oc1c2cccc1)Nc1ccccc1

 

Upstream Synthesis Route 
  • 1-Benzofuro[3,2-d]pyrimidin-4-yl-N-phenyl-3-piperidinecarboxamide is a versatile compound widely utilized in organic chemistry for its applications in chemical synthesis. This compound serves as an important building block in the creation of various pharmaceuticals, agrochemicals, and materials. With its unique structural features, 1-Benzofuro[3,2-d]pyrimidin-4-yl-N-phenyl-3-piperidinecarboxamide plays a crucial role in the development of novel compounds with potential biological activities. Its incorporation into molecular designs enables the synthesis of new drug candidates, bioactive molecules, and functional materials, making it a valuable tool in the field of medicinal and organic chemistry.
FEATURED PRODUCTS