AE12802
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | in stock | $184.00 | $129.00 | - + | ||
25g | in stock | $509.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE12802 |
Chemical Name: | METHYL 9,10-DIHYDROXYOCTADECANOATE |
CAS Number: | 1115-01-1 |
Molecular Formula: | C19H38O4 |
Molecular Weight: | 330.5026 |
MDL Number: | MFCD00144775 |
SMILES: | CCCCCCCCC(C(CCCCCCCC(=O)OC)O)O |
Methyl 9,10-dihydroxystearate, a versatile compound in chemical synthesis, serves as a crucial intermediate in the production of various functional chemicals and materials. Its unique chemical structure and properties make it an essential ingredient in the formulation of cosmetics, pharmaceuticals, and other industrial products. In chemical synthesis, this compound is utilized as a building block for the creation of different esters and derivatives, which play a vital role in the development of specialty chemicals and advanced materials. With its hydroxyl groups and alkyl chain, Methyl 9,10-dihydroxystearate enables the synthesis of complex molecules with specific functionalities and structures, making it a valuable component in the production of a wide range of compounds with diverse applications. The versatility and compatibility of this compound make it a preferred choice for researchers and chemists working on innovative projects in the field of chemical synthesis.