logo
Home  > Silane,[[(1a,3b,5E,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-

AI68252

111594-58-2 | Silane,[[(1a,3b,5E,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-

Packsize Purity Availability Price Discounted Price    Quantity
1g 1 week $828.00 $580.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI68252
Chemical Name: Silane,[[(1a,3b,5E,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-
CAS Number: 111594-58-2
Molecular Formula: C40H72O2Si2
Molecular Weight: 641.1695
MDL Number: MFCD11977660
SMILES: CC([C@H](/C=C/[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCC/C/2=C\C=C\1/C[C@H](C[C@@H](C1=C)O[Si](C(C)(C)C)(C)C)O[Si](C(C)(C)C)(C)C)C)C)C

 

Upstream Synthesis Route 
  • Silane, [[(1a,3b,5E,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it an essential reagent in various reactions. In chemical synthesis, Silane can serve as a coupling agent, promoting the formation of covalent bonds between organic molecules. This enables the creation of complex organic compounds with precise control over the structure and properties. Additionally, Silane can act as a protecting group, shielding reactive functional groups during specific chemical transformations to ensure selective reactions occur. Its compatibility with a wide range of substrates and reaction conditions makes Silane a valuable tool for synthetic chemists seeking to efficiently and effectively manipulate molecular structures.
FEATURED PRODUCTS