logo
Home  > Fmoc-Phe-Lys(Trt)-PAB-PNP

AX62657

1116086-09-9 | Fmoc-Phe-Lys(Trt)-PAB-PNP

Packsize Purity Availability Price Discounted Price    Quantity
25mg 98% 1 week $153.00 $107.00 -   +
50mg 98% 1 week $258.00 $180.00 -   +
100mg 98% 1 week $439.00 $307.00 -   +
250mg 98% 1 week $833.00 $583.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AX62657
Chemical Name: Fmoc-Phe-Lys(Trt)-PAB-PNP
CAS Number: 1116086-09-9
Molecular Formula: C63H57N5O9
Molecular Weight: 1028.1548
MDL Number: MFCD28898938
SMILES: O=C(Oc1ccc(cc1)[N+](=O)[O-])OCc1ccc(cc1)N(C(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2c1cccc2)[C@H](C(=O)N)CCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1

 

Upstream Synthesis Route 
  • N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-phenylalanyl-N-[4-[[[(4-nitrophenoxy)carbonyl]oxy]methyl]phenyl]-N6-(triphenylmethyl)-L-lysinamide is a compound commonly used in chemical synthesis as a protecting group for various functional groups on amino acids. This compound plays a crucial role in peptide synthesis by selectively blocking certain reactive sites of amino acids, allowing for specific reactions to occur at desired locations. By strategically incorporating this compound into the synthesis process, chemists are able to control the order of reactions and manipulate the chemical properties of amino acids, ultimately leading to the creation of complex peptides with precise structures and functionalities.
FEATURED PRODUCTS