AD75628
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $125.00 | $87.00 | - + | |
50mg | 95% | in stock | $178.00 | $124.00 | - + | |
100mg | 95% | in stock | $251.00 | $176.00 | - + | |
250mg | 95% | in stock | $403.00 | $282.00 | - + | |
1g | 95% | in stock | $835.00 | $585.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD75628 |
Chemical Name: | Fmoc-gla(otbu)2-oh |
CAS Number: | 111662-64-7 |
Molecular Formula: | C29H35NO8 |
Molecular Weight: | 525.5901 |
MDL Number: | MFCD00038770 |
SMILES: | O=C(N[C@H](C(=O)O)CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 823 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 38 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 13 |
XLogP3: | 5 |
The (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(tert-butoxy)-4-(tert-butoxycarbonyl)-5-oxopentanoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis processes. Its primary application lies in the field of peptide synthesis, where it serves as a key building block for creating complex peptides. $name$ plays a crucial role in peptide chemistry by acting as a protecting group for amino acids during synthesis. The tert-butoxycarbonyl (Boc) and fluorenylmethoxycarbonyl (Fmoc) groups present in $name$ are specifically designed to shield reactive functional groups within the peptide chain, allowing for selective and controlled reactions at targeted sites. Moreover, $name$ facilitates the assembly of peptides with high purity and efficiency, ensuring the accurate sequence of amino acids in the final product. Its unique structure and properties make it a valuable tool for chemists and researchers involved in the development of novel peptides for various applications in biotechnology, pharmaceuticals, and materials science.