AX17348
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $525.00 | $368.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX17348 |
Chemical Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-ar-carboxylic acid,2',7'-dichloro-3',6'-dihydroxy-3-oxo- |
CAS Number: | 111843-78-8 |
Molecular Formula: | C42H20Cl4O14 |
Molecular Weight: | 890.4118 |
MDL Number: | MFCD00037452 |
SMILES: | OC(=O)c1ccc(c(c1)c1c2-c(oc3c1cc(Cl)c(c3)O)cc(=O)c(c2)Cl)C(=O)O.OC(=O)c1ccc(c(c1)C(=O)O)c1c2-c(oc3c1cc(Cl)c(c3)O)cc(=O)c(c2)Cl |
5(6)-Carboxy-2',7'-dichlorofluorescein, also known as CDCF, is a versatile fluorescent dye extensively utilized in chemical synthesis processes due to its unique properties. This compound serves as a valuable tool in various applications, particularly in the realm of organic chemistry. One key use of CDCF is as a fluorescent label for monitoring reactions and studying kinetics in real-time. Its bright fluorescence under appropriate excitation wavelengths makes it ideal for tracking reaction progress and determining reaction efficiency.Additionally, 5(6)-Carboxy-2',7'-dichlorofluorescein can function as a sensitive probe for detecting changes in pH levels within a reaction system. Its fluorescence properties are known to be pH-dependent, allowing for precise monitoring of acid-base reactions and pH shifts during chemical transformations. This feature is particularly advantageous in catalytic studies and optimization of reaction conditions.Moreover, CDCF has found utility in the development of fluorescent sensors and indicators for detecting various analytes in complex chemical mixtures. By modifying its structure or incorporating it into specific molecular frameworks, this dye can be tailored to selectively recognize and report the presence of target molecules or ions. Such tailored fluorescent probes are essential in bioconjugation studies, molecular imaging, and biological assays.In summary, the application of 5(6)-Carboxy-2',7'-dichlorofluorescein in chemical synthesis is multifaceted, ranging from real-time monitoring of reactions to pH sensing and selective detection of analytes. Its versatility and sensitivity as a fluorescent dye make it a valuable tool for chemists seeking to enhance their understanding of complex reaction mechanisms and optimize synthetic processes.