AE10177
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10177 |
Chemical Name: | 9-AMINO-N-ACETYLNEURAMINIC ACID |
CAS Number: | 112037-47-5 |
Molecular Formula: | C11H20N2O8 |
Molecular Weight: | 308.2851 |
MDL Number: | MFCD09841684 |
SMILES: | NC[C@H]([C@H]([C@@H]([C@@H]([C@H](CC(=O)C(=O)O)O)NC(=O)C)O)O)O |
N-Acetyl-9-deoxy-9-aminoneuraminic Acid holds a crucial role in chemical synthesis, particularly in the development of various pharmaceuticals and functional molecules. This compound serves as a key building block in creating complex organic structures with tailored properties. Its unique chemical composition allows for precise manipulation and selective functionalization, making it a versatile tool for constructing diverse molecular frameworks. In chemical synthesis, N-Acetyl-9-deoxy-9-aminoneuraminic Acid facilitates the formation of intricate molecular architectures, enabling researchers to design and produce novel compounds with targeted functionalities and applications. Its strategic utilization opens up a myriad of possibilities for the creation of advanced materials, therapeutic agents, and technological innovations.