AE08762
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $72.00 | $51.00 | - + | |
5mg | 97% | in stock | $321.00 | $225.00 | - + | |
10mg | 97% | in stock | $603.00 | $423.00 | - + | |
50mg | 97% | in stock | $2,122.00 | $1,485.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08762 |
Chemical Name: | (+/-)-15-DEOXY-[16RS]-16-HYDROXY-16-METHYLPROSTAGLANDIN E1 |
CAS Number: | 112137-89-0 |
Molecular Formula: | C21H36O5 |
Molecular Weight: | 368.5075 |
MDL Number: | MFCD00869984 |
SMILES: | CCCCC(CC=CC1C(O)CC(=O)C1CCCCCCC(=O)O)(O)C |
The compound $name$, also known as 7-((1R,2R,3R)-3-Hydroxy-2-((E)-4-hydroxy-4-methyloct-1-en-1-yl)-5-oxocyclopentyl)heptanoic acid, is commonly utilized in chemical synthesis as a versatile building block for the creation of complex organic molecules. Its unique structure and functional groups make it a valuable intermediate in the preparation of various bioactive compounds, pharmaceuticals, and natural products. By incorporating $name$ into synthetic pathways, chemists can introduce specific stereochemical features and functional groups that are crucial for controlling the reactivity and properties of the final products. This compound serves as a valuable tool for organic chemists seeking to design and construct intricate molecular architectures with tailored properties and activities.