AE15189
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15189 |
Chemical Name: | GADOTERIDOL RELATED COMPOUND B (50 MG) (1,4,7,10-TETRAAZACYCLODODECANE-1,4,7-TRIACETIC ACID, MONOGADOLINIUM SALT) |
CAS Number: | 112188-16-6 |
Molecular Formula: | C14H22GdN4O6- |
Molecular Weight: | 499.5977 |
MDL Number: | MFCD28976075 |
SMILES: | [O-]C(=O)CN1CCN(CC[N-]CCN(CC1)CC(=O)[O-])CC(=O)[O-].[Gd+3] |
1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, gadolinium complex is a versatile compound widely utilized in chemical synthesis due to its unique properties and applications. In chemical synthesis, this complex serves as a powerful chelating agent that can coordinate with various metal ions, including gadolinium. This coordination ability is crucial for forming stable complexes with metal ions, which can be further employed in a variety of synthetic reactions and processes.One key application of 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, gadolinium complex is in catalysis, where it can function as a catalyst or a co-catalyst for a range of chemical transformations. Its ability to bind to metal ions like gadolinium enables it to participate in catalytic reactions, enhancing reaction rates and selectivity. Additionally, this complex can be employed in asymmetric synthesis, where the chiral nature of the compound can influence the stereochemistry of the final products.Furthermore, 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, gadolinium complex finds utility in coordination chemistry, where its chelating properties are exploited for the synthesis of coordination polymers and supramolecular structures. By forming stable complexes with metal ions, this compound can act as a building block for designing intricate molecular architectures with specific functionalities.Overall, the application of 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, gadolinium complex in chemical synthesis showcases its significance in advancing synthetic methodologies and enabling the creation of diverse chemical compounds with tailored properties and applications.