AE15864
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $81.00 | $57.00 | - + | |
250mg | 95% | in stock | $188.00 | $132.00 | - + | |
500mg | 95% | in stock | $297.00 | $208.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15864 |
Chemical Name: | Tri-tert-butylphosphine gold(i) bis(trifluoromethylsulfonyl)imide |
CAS Number: | 1121960-93-7 |
Molecular Formula: | C14H27AuF6NO4PS2 |
Molecular Weight: | 679.4292 |
MDL Number: | MFCD21363047 |
SMILES: | FC(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)(F)F.CC(P(C(C)(C)C)C(C)(C)C)(C)C.[Au+] |
Tri-t-butylphosphine[bis(trifluoroMethyl)sulfonyliMido]gold(I) is a highly versatile organometallic compound that finds wide application in chemical synthesis. This complex offers exceptional catalytic properties in various organic reactions due to its unique structure and reactivity. In particular, it is known for its use as a catalyst in cross-coupling reactions, such as the Suzuki-Miyaura coupling, Sonogashira coupling, and Heck reaction. These reactions are essential in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and materials. Additionally, this gold complex has shown promising results in asymmetric transformations, making it a valuable tool for the preparation of chiral compounds. Its ability to facilitate C-C and C-X bond formations under mild conditions with high efficiency and selectivity makes it a popular choice among synthetic chemists seeking to streamline their synthetic routes and achieve intricate molecular designs.