AE11551
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $74.00 | $52.00 | - + | |
10mg | 95% | in stock | $100.00 | $70.00 | - + | |
25mg | 95% | in stock | $213.00 | $149.00 | - + | |
50mg | 95% | in stock | $293.00 | $205.00 | - + | |
100mg | 95% | in stock | $532.00 | $372.00 | - + | |
250mg | 95% | in stock | $832.00 | $582.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11551 |
Chemical Name: | SITRAVATINIB |
CAS Number: | 1123837-84-2 |
Molecular Formula: | C33H29F2N5O4S |
Molecular Weight: | 629.6763 |
MDL Number: | MFCD28502181 |
SMILES: | COCCNCc1ccc(nc1)c1sc2c(c1)nccc2Oc1ccc(cc1F)NC(=O)C1(CC1)C(=O)Nc1ccc(cc1)F |
N-[3-Fluoro-4-[[2-[5-[[(2-methoxyethyl)amino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxy]phenyl]-N'-(4-fluorophenyl)-1,1-cyclopropanedicarboxamide, commonly used in chemical synthesis, plays a crucial role as a versatile building block in the creation of novel compounds. Its unique structure and properties make it a valuable tool in the development of pharmaceuticals, agrochemicals, and materials. By serving as a key intermediate, this compound facilitates the construction of diverse molecular scaffolds, enabling researchers to explore new pathways and compounds for various applications.