1124-18-1 | Methyl-d3-benzene

Packsize	Purity	Availability	Price	Discounted Price
1g	98%	1 week	$307.00	$215.00
5g	98%	1 week	$1,022.00	$715.00

Description

• Catalog Number: AB53520
• Chemical Name: Methyl-d3-benzene
• CAS Number: 1124-18-1
• Molecular Formula: C7H5D3
• Molecular Weight: 95.1569
• MDL Number: MFCD00084185
• SMILES: [2H]C(c1ccccc1)([2H])[2H]

Upstream Synthesis Route

Methyl-d3-benzene, also known as toluene-d3, is a deuterated form of toluene where three hydrogen atoms are replaced with deuterium atoms. This isotopically labeled compound has a wide range of applications in chemical synthesis, particularly in organic chemistry research and pharmaceutical development. In chemical synthesis, Methyl-d3-benzene is commonly used as a solvent, reagent, or precursor in various reactions due to its unique isotopic properties. The deuterium atoms in Methyl-d3-benzene can serve as tracers in reaction mechanisms and help researchers investigate the pathways of chemical transformations. Additionally, the presence of deuterium can alter the physical and chemical properties of Methyl-d3-benzene, leading to selective isotopic labeling in complex molecules.Researchers utilize Methyl-d3-benzene in the synthesis of labeled organic compounds, such as pharmaceutical intermediates, agrochemicals, and specialty chemicals. By incorporating deuterium-labeled fragments into target molecules, chemists can track the fate of specific functional groups during reactions, elucidate reaction pathways, and study the behavior of molecules in biological systems. Overall, Methyl-d3-benzene plays a crucial role in advancing our understanding of chemical processes, facilitating the development of new molecules with tailored properties, and enabling breakthroughs in various fields of chemistry and materials science.