AB59043
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $330.00 | $231.00 | - + | |
1g | 98% | in stock | $789.00 | $553.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB59043 |
Chemical Name: | 4-Chloro-2-fluoro-5-methylphenylboronic acid, pinacol ester |
CAS Number: | 1126320-27-1 |
Molecular Formula: | C13H17BClFO2 |
Molecular Weight: | 270.5353 |
MDL Number: | MFCD11855985 |
SMILES: | CC1(C)OB(OC1(C)C)c1cc(C)c(cc1F)Cl |
Complexity: | 308 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
2-(4-Chloro-2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a versatile reagent widely utilized in modern chemical synthesis processes. As a boronic ester, it serves as a key building block for the synthesis of various biologically active compounds, pharmaceuticals, agrochemicals, and materials.This compound plays a crucial role in Suziki-Miyaura cross-coupling reactions, allowing for the efficient formation of carbon-carbon bonds under mild reaction conditions. By introducing this boronic ester into the reaction mixture, chemists can selectively modulate the regioselectivity and stereochemistry of the resulting products, enabling the synthesis of complex molecular structures with high efficiency.Moreover, 2-(4-Chloro-2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is valued for its stability and compatibility with a wide range of functional groups, making it a valuable tool for chemists seeking to streamline their synthetic routes and enhance the overall yield and purity of their target compounds.