AE08400
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $169.00 | $118.00 | - + | |
250mg | 97% | in stock | $305.00 | $214.00 | - + | |
500mg | 97% | in stock | $337.00 | $236.00 | - + | |
1g | 97% | in stock | $472.00 | $331.00 | - + | |
5g | 97% | in stock | $1,287.00 | $901.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08400 |
Chemical Name: | Boc-beta-t-butyl-d-alanine |
CAS Number: | 112695-98-4 |
Molecular Formula: | C12H23NO4 |
Molecular Weight: | 245.3153 |
MDL Number: | MFCD00798621 |
SMILES: | O=C(OC(C)(C)C)N[C@@H](C(=O)O)CC(C)(C)C |
Complexity: | 286 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.6 |
The chiral compound (R)-2-((tert-Butoxycarbonyl)amino)-4,4-dimethylpentanoic acid plays a crucial role in chemical synthesis as a versatile building block in the production of pharmaceuticals, agrochemicals, and advanced materials. This compound, due to its unique stereochemistry, serves as a key intermediate in the synthesis of complex molecules with specific biological activities or material properties. The (R)-configuration of this compound imparts specific stereochemical features to the molecules it is incorporated into, enhancing the desired chemical and biological properties. This compound is particularly valued in asymmetric synthesis strategies, where the control of stereochemistry is critical for the activity or selectivity of the final product.