logo
Home  > 1-(4-(tert-butyl)cyclohexyl)azetidine-3-carboxylic acid

AV12929

1127402-31-6 | 1-(4-(tert-butyl)cyclohexyl)azetidine-3-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% 3 weeks $574.00 $402.00 -   +
5mg 95% 3 weeks $639.00 $447.00 -   +
10mg 95% 3 weeks $685.00 $479.00 -   +
25mg 95% 3 weeks $850.00 $595.00 -   +
50mg 95% 3 weeks $1,194.00 $836.00 -   +
100mg 95% 3 weeks $1,654.00 $1,158.00 -   +
1g 95% 3 weeks $3,513.00 $2,459.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AV12929
Chemical Name: 1-(4-(tert-butyl)cyclohexyl)azetidine-3-carboxylic acid
CAS Number: 1127402-31-6
Molecular Formula: C14H25NO2
Molecular Weight: 239.3538
MDL Number: MFCD20954809
SMILES: OC(=O)C1CN(C1)C1CCC(CC1)C(C)(C)C

 

Upstream Synthesis Route 
  • $Name$ is a versatile compound that plays a crucial role in chemical synthesis as a building block for creating novel molecules. Due to its unique structure and functional groups, 1-(4-(tert-butyl)cyclohexyl)azetidine-3-carboxylic acid is highly sought after by chemists looking to introduce specific structural motifs or functionalities into their target compounds. In synthetic chemistry, this compound can be utilized as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and materials. Its incorporation can lead to the enhancement of desired properties or biological activities in the final products. Additionally, its structural flexibility allows for diversification through further derivatization, making it a valuable tool for designing and synthesizing complex molecular architectures.
FEATURED PRODUCTS