AD62817
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $250.00 | $175.00 | - + | |
1g | 98% | in stock | $600.00 | $420.00 | - + | |
5g | 98% | in stock | $2,293.00 | $1,605.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD62817 |
Chemical Name: | (2E,4R)-4-[(1R,3aS,4E,7aR)-4-[(2E)-2-[(3S,5R)-3,5-Bis[[(tert-butyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethylidene]octahydro-7a-methyl-1H-inden-1-yl]-1-cyclopropyl-2-penten-1-one |
CAS Number: | 112849-17-9 |
Molecular Formula: | C39H66O3Si2 |
Molecular Weight: | 639.1105 |
MDL Number: | MFCD09833393 |
SMILES: | O=C(C1CC1)/C=C/[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCC/C/2=C\C=C\1/C[C@H](C[C@@H](C1=C)O[Si](C(C)(C)C)(C)C)O[Si](C(C)(C)C)(C)C)C |
The compound 1(S),3(R),20(R)-bis(tert-butyldimethylsilyloxy)-20-(3-cyclopropyl-3-oxyprop-1(E)-enyl)-9,10-secopregna-5(E),10(19)triene is commonly used in chemical synthesis as a versatile building block. Its specific stereochemistry and functional groups make it a valuable intermediate in the synthesis of complex organic molecules. One of its key applications is in the preparation of steroidal derivatives, where its unique structural features allow for the introduction of various functional groups in a controlled manner. This compound serves as a strategic starting material for the synthesis of diverse bioactive compounds and pharmaceutical agents.