AB77390
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $13.00 | $9.00 | - + | |
10g | 98% | in stock | $22.00 | $16.00 | - + | |
500g | 98% | in stock | $882.00 | $618.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77390 |
Chemical Name: | N-Fmoc-3-(2-naphthyl)-L-alanine |
CAS Number: | 112883-43-9 |
Molecular Formula: | C28H23NO4 |
Molecular Weight: | 437.4865 |
MDL Number: | MFCD00144886 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccc2c(c1)cccc2)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 673 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 5.9 |
Fmoc-2-Nal-OH, also known as Fmoc-2-naphthylalanine, is a key component in chemical synthesis due to its versatile applications. This compound is commonly used in solid-phase peptide synthesis (SPPS) as a building block for constructing peptides with specific characteristics and functions. Fmoc-2-Nal-OH contains a fluorenylmethyloxycarbonyl (Fmoc) protecting group which facilitates its selective deprotection under mild acidic conditions, allowing for efficient peptide assembly.In peptide synthesis, Fmoc-2-Nal-OH can be coupled with other amino acids to form peptide bonds, leading to the formation of linear peptide chains. The unique structure of 2-naphthylalanine confers specific properties to the peptides, making them valuable in various biological and pharmaceutical applications. These peptides can be further modified or functionalized to enhance their activity or targeting capabilities.Additionally, Fmoc-2-Nal-OH is valuable in the synthesis of peptide-based materials, such as hydrogels, biomaterials, and drug delivery systems. Its compatibility with solid-phase synthesis techniques allows for precise control over the peptide sequence and structure, enabling the design of novel materials with tailored properties.Overall, Fmoc-2-Nal-OH serves as a critical building block in the realm of chemical synthesis, offering researchers a powerful tool for creating complex peptides and peptide-based materials with diverse applications across the fields of chemistry, biology, and pharmaceutical science.