logo
Home  > Mosapride citrate

AD37690

112885-42-4 | Mosapride citrate

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $7.00 $5.00 -   +
10mg 98% in stock $12.00 $9.00 -   +
50mg 98% in stock $21.00 $15.00 -   +
1g 98%(HPLC)powder in stock $40.00 $28.00 -   +
5g 98%(HPLC)powder in stock $90.00 $63.00 -   +
10g 98% in stock $114.00 $80.00 -   +
25g 98% in stock $227.00 $159.00 -   +
100g 98% in stock $562.00 $393.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD37690
Chemical Name: Mosapride citrate
CAS Number: 112885-42-4
Molecular Formula: C27H33ClFN3O10
Molecular Weight: 614.0164
MDL Number: MFCD01666680
SMILES: OC(=O)CC(C(=O)O)(CC(=O)O)O.CCOc1cc(N)c(cc1C(=O)NCC1OCCN(C1)Cc1ccc(cc1)F)Cl

 

Upstream Synthesis Route 
  • Benzamide, 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]-2-morpholinyl]methyl]-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1) is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the introduction of multiple functional groups, making it a valuable intermediate in the creation of complex molecules. In chemical synthesis, this compound serves as a key component in the construction of heterocyclic compounds and drug candidates. Its ability to undergo diverse reactions and form intricate molecular structures makes it a valuable tool for chemists in designing new compounds with desired properties.
FEATURED PRODUCTS