AB46170
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $20.00 | $14.00 | - + | |
10g | 98% | in stock | $32.00 | $23.00 | - + | |
25g | 98% | in stock | $57.00 | $40.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46170 |
Chemical Name: | Fmoc-D-Gln-OH |
CAS Number: | 112898-00-7 |
Molecular Formula: | C20H20N2O5 |
Molecular Weight: | 368.3832 |
MDL Number: | MFCD00062959 |
SMILES: | NC(=O)CC[C@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 545 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 8 |
XLogP3: | 1.9 |
The compound N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-glutamine is a versatile reagent used in chemical synthesis for the incorporation of the D-glutamine moiety into various molecules. Its unique structure, characterized by the presence of the fluorenyl group, provides enhanced stability and reactivity in a range of synthetic reactions. When utilized in organic synthesis, this compound serves as a valuable building block for constructing complex organic molecules with precise stereochemistry and functional group compatibility. Its application extends to the development of pharmaceuticals, agrochemicals, and materials science, where the controlled introduction of D-glutamine functionality is crucial for modulating biological activity or material properties. Additionally, the presence of the carbonyl group allows for further derivatization, enabling the synthesis of diverse analogs with tailored properties. In summary, N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-glutamine plays a pivotal role in chemical synthesis by facilitating the efficient and controlled incorporation of D-glutamine functionality into a wide array of compounds, thereby enabling the discovery of novel molecules with desired properties and applications.