112921-04-7 | Adenosine,5'-[N-[(2S)-2-amino-1-oxopropyl]sulfamate]

Availability
Typically In Stock

Description

• Catalog Number: AD75232
• Chemical Name: Adenosine,5'-[N-[(2S)-2-amino-1-oxopropyl]sulfamate]
• CAS Number: 112921-04-7
• Molecular Formula: C13H19N7O7S
• Molecular Weight: 417.3977
• SMILES: O=C([C@@H](N)C)NS(=O)(=O)OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N

Upstream Synthesis Route

Adenosine, 5'-[N-[(2S)-2-amino-1-oxopropyl]sulfamate] is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This molecule serves as a valuable building block in the preparation of various pharmaceuticals, nucleoside analogs, and bioconjugates. Its sulfamate group provides a reactive handle for selective conjugation to other molecules, enabling the creation of novel compounds with desired functionalities. The presence of the adenosine moiety further enhances the biological potential of resulting molecules, making this reagent crucial in medicinal chemistry and drug development. In summary, the application of Adenosine, 5'-[N-[(2S)-2-amino-1-oxopropyl]sulfamate] in chemical synthesis lies in its ability to facilitate the construction of complex molecular structures with tailored properties and biological activities.