AX66939
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $12.00 | $9.00 | - + | |
5mg | 99% | in stock | $30.00 | $21.00 | - + | |
10mg | 99% | in stock | $42.00 | $30.00 | - + | |
25mg | 99% | in stock | $60.00 | $42.00 | - + | |
50mg | 99% | in stock | $85.00 | $60.00 | - + | |
100mg | 99% | in stock | $140.00 | $98.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX66939 |
Chemical Name: | 2,1,3-Benzoxadiazole, 4-nitro-7-[(1-oxido-2-pyridinyl)thio]- |
CAS Number: | 113104-25-9 |
Molecular Formula: | C11H6N4O4S |
Molecular Weight: | 290.2547 |
MDL Number: | MFCD30747875 |
SMILES: | O=n1ccccc1Sc1ccc(c2c1non2)N(=O)=O |
NSC228155 is a versatile tool in the realm of chemical synthesis, primarily utilized as a potent small molecule inhibitor. Its distinctive structure and remarkable reactivity make it an invaluable asset in the development of novel chemical compounds and the exploration of diverse chemical reactions. In the realm of organic synthesis, NSC228155 serves as a critical building block for the construction of elaborate molecular frameworks, enabling chemists to access complex structures efficiently and with high precision. Additionally, its unique properties make it a valuable tool for investigating reaction mechanisms and catalytic processes, shedding light on fundamental principles in chemical reactivity. This compound's multifaceted utility underscores its significance in advancing the frontiers of chemical synthesis and catalysis.