logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Tetrahydropyrans  > Tetrahydropyran-4-boronic acid, pinacol ester

AB50425

1131912-76-9 | Tetrahydropyran-4-boronic acid, pinacol ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $21.00 $15.00 -   +
250mg 97% in stock $26.00 $19.00 -   +
1g 97% in stock $65.00 $46.00 -   +
5g 97% in stock $265.00 $186.00 -   +
10g 97% in stock $480.00 $336.00 -   +
25g 97% in stock $980.00 $686.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB50425
Chemical Name: Tetrahydropyran-4-boronic acid, pinacol ester
CAS Number: 1131912-76-9
Molecular Formula: C11H21BO3
Molecular Weight: 212.0936
MDL Number: MFCD00667560
SMILES: CC1(C)OB(OC1(C)C)C1CCOCC1

 

Computed Properties
Complexity: 218  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 1  

 

 

Upstream Synthesis Route 
  • The unique structure of Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran makes it a versatile compound in chemical synthesis. This compound is commonly employed as a building block in organic chemistry reactions, particularly in the formation of complex molecules. Due to its boron-containing group, Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran can participate in various cross-coupling reactions such as Suzuki-Miyaura coupling, allowing for the efficient creation of carbon-carbon bonds. Additionally, this compound's cyclic structure lends itself well to applications in heterocyclic chemistry, enabling the synthesis of diverse heterocyclic compounds with potential biological or materials science applications. In summary, Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran serves as a valuable tool for chemists seeking to access novel compounds through strategic synthetic pathways.
FEATURED PRODUCTS