AD75693
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $175.00 | $123.00 | - + | |
100mg | 95% | 1 week | $223.00 | $157.00 | - + | |
250mg | 95% | 1 week | $281.00 | $197.00 | - + | |
500mg | 95% | 1 week | $397.00 | $278.00 | - + | |
1g | 95% | 1 week | $487.00 | $341.00 | - + | |
2.5g | 95% | 1 week | $924.00 | $647.00 | - + | |
5g | 95% | 1 week | $1,652.00 | $1,156.00 | - + | |
10g | 95% | 1 week | $3,109.00 | $2,176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD75693 |
Chemical Name: | TERT-BUTYL (4-(METHYLAMINO)PHENYL)CARBAMATE |
CAS Number: | 113283-94-6 |
Molecular Formula: | C12H18N2O2 |
Molecular Weight: | 222.28352 |
MDL Number: | MFCD11858354 |
SMILES: | CNc1ccc(cc1)NC(=O)OC(C)(C)C |
The tert-Butyl (4-(methylamino)phenyl)carbamate is a versatile compound widely employed in chemical synthesis due to its unique reactivity and functional groups. This compound serves as an essential building block in the creation of various pharmaceuticals, agrochemicals, and other fine chemicals. Its incorporation into organic reactions allows for the introduction of the tert-butyl group, the methylamino group, and the carbamate functionality simultaneously, enabling efficient and controlled modifications of complex molecular structures. Furthermore, the presence of these specific groups imparts desirable properties, such as increased stability, lipophilicity, and potential for further derivatization, making it a valuable tool in the design and development of novel molecules with diverse applications.