logo
Home  > 3-(2,4-Dimethyl-5-formyl-1h-pyrrole-3-yl)propanoic acid

AD38010

1133-96-6 | 3-(2,4-Dimethyl-5-formyl-1h-pyrrole-3-yl)propanoic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $463.00 $324.00 -   +
250mg 97% in stock $832.00 $582.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD38010
Chemical Name: 3-(2,4-Dimethyl-5-formyl-1h-pyrrole-3-yl)propanoic acid
CAS Number: 1133-96-6
Molecular Formula: C10H13NO3
Molecular Weight: 195.2151
MDL Number: MFCD02684433
SMILES: O=Cc1[nH]c(c(c1C)CCC(=O)O)C

 

Upstream Synthesis Route 
  • The 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoic acid plays a crucial role in chemical synthesis as a versatile building block. Its unique structure allows it to participate in various reactions, leading to the formation of complex molecules. This compound can be used as a key intermediate in the synthesis of diverse organic compounds, including pharmaceuticals, agrochemicals, and materials. Its functional groups enable selective modifications that are essential for the creation of specific molecular structures. Furthermore, the presence of the formyl group provides a site for further derivatization, expanding the compound's synthetic utility. Overall, the 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoic acid serves as a valuable tool in the hands of synthetic chemists for the construction of intricate and diverse chemical entities.
FEATURED PRODUCTS