AE18073
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $36.00 | $25.00 | - + | |
1g | 95% | in stock | $53.00 | $38.00 | - + | |
25g | 95% | in stock | $1,319.00 | $923.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18073 |
Chemical Name: | tert-Butyl 2-methylbut-3-yn-2-ylcarbamate |
CAS Number: | 113486-06-9 |
Molecular Formula: | C10H17NO2 |
Molecular Weight: | 183.24748 |
MDL Number: | MFCD16036595 |
SMILES: | C#CC(NC(=O)OC(C)(C)C)(C)C |
Tert-Butyl (2-methylbut-3-yn-2-yl)carbamate, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in various reactions, acting as a protective group for amines. In organic chemistry, the tert-butyl (2-methylbut-3-yn-2-yl)carbamate moiety serves as a protecting group for amines, preventing unwanted reactions at the amine nitrogen atom during a multi-step synthesis. By selectively blocking the amino group, this compound allows for the manipulation of other functional groups without affecting the amine's reactivity.Additionally, tert-butyl (2-methylbut-3-yn-2-yl)carbamate is utilized in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its unique chemical properties make it a valuable building block in the preparation of complex molecules with specific stereochemical requirements. This compound enables chemists to achieve precise control over the reaction pathways and selectivity of various transformations, facilitating the creation of new molecules with enhanced properties.In summary, tert-butyl (2-methylbut-3-yn-2-yl)carbamate plays a crucial role in chemical synthesis by serving as a protecting group for amines, enabling the efficient manipulation of functional groups and the synthesis of diverse compounds across different industries.