AA11327
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $7.00 | $5.00 | - + | |
25mg | 95% | in stock | $20.00 | $14.00 | - + | |
100mg | 95% | in stock | $56.00 | $39.00 | - + | |
1g | 95% | in stock | $249.00 | $174.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA11327 |
Chemical Name: | Cid24768606 hydrate |
CAS Number: | 1135243-19-4 |
Molecular Formula: | C18H20N6O3S2 |
Molecular Weight: | 432.5198 |
MDL Number: | MFCD18086889 |
SMILES: | O=C(N1CCN(CC1)c1ccncc1)CCNS(=O)(=O)c1cccc2c1nsn2 |
Complexity: | 659 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.7 |
Bioorganic & medicinal chemistry letters 20120801
The Journal of pharmacology and experimental therapeutics 20120301
Molecular pharmacology 20090801
Current topics in medicinal chemistry 20090101