1137-69-5 | 2-Chlorophenazine

Packsize	Purity	Availability	Price	Discounted Price
250mg	95%	in stock	$400.00	$280.00
1g	95%	in stock	$946.00	$662.00

Description

• Catalog Number: AE22407
• Chemical Name: 2-Chlorophenazine
• CAS Number: 1137-69-5
• Molecular Formula: C12H7ClN2
• Molecular Weight: 214.6504
• MDL Number: MFCD00448557
• SMILES: Clc1ccc2c(c1)nc1c(n2)cccc1

Upstream Synthesis Route

2-Chlorophenazine is a versatile compound that finds application in various chemical synthesis processes. As a chlorinated derivative of phenazine, it serves as a valuable building block for the creation of complex organic molecules. In chemical synthesis, 2-Chlorophenazine is commonly used as a key intermediate in the production of pharmaceuticals, agrochemicals, and dyes.Its unique structure and reactivity make it a significant component in the development of novel compounds with potentially beneficial properties. By incorporating 2-Chlorophenazine into synthetic routes, chemists can explore different pathways to access a wide range of functionalized products. Its ability to undergo diverse chemical transformations enables the synthesis of structurally diverse molecules with enhanced biological activities.Furthermore, the presence of the chloro group in 2-Chlorophenazine offers selective reactivity patterns, allowing chemists to control and direct the formation of specific bonds during the synthetic process. This level of selectivity is crucial for the efficient construction of complex molecules with high purity and yield. Overall, 2-Chlorophenazine plays a crucial role in advancing chemical synthesis strategies and expanding the scope of organic chemistry research.