1137-73-1 | N-Phenyliminodiacetic acid

Packsize	Purity	Availability	Price	Discounted Price
1g	95%	in stock	$98.00	$69.00
10g	95%	in stock	$184.00	$129.00

Description

• Catalog Number: AA11963
• Chemical Name: N-Phenyliminodiacetic acid
• CAS Number: 1137-73-1
• Molecular Formula: C10H11NO4
• Molecular Weight: 209.1986
• MDL Number: MFCD00043570
• SMILES: OC(=O)CN(c1ccccc1)CC(=O)O

Upstream Synthesis Route

2,2'-(Phenylazanediyl)diacetic acid, also known as PAD, is a versatile compound widely used in chemical synthesis for its exceptional properties. In organic chemistry, PAD serves as a valuable building block for the preparation of various functionalized materials and molecular structures. Its unique structure allows for efficient incorporation into complex molecules, enabling the synthesis of novel compounds with diverse applications.PAD is commonly employed as a coupling reagent in peptide synthesis, facilitating the formation of peptide bonds between amino acid residues. Additionally, it serves as a key component in the preparation of dendrimers, polymers, and other macromolecular structures through controlled polymerization reactions. The presence of the azo group in PAD enables it to participate in photochemical reactions, making it a useful tool in photoresponsive materials and photochromic compounds.Furthermore, PAD's ability to chelate metal ions makes it valuable in coordination chemistry, where it can act as a ligand to stabilize metal complexes and influence their reactivity. Its acid functionality allows for easy modification to tailor its properties for specific applications, making it a versatile tool for synthetic chemists in developing new materials and molecules.Overall, 2,2'-(Phenylazanediyl)diacetic acid plays a crucial role in chemical synthesis by enabling the construction of complex molecules with tailored properties and functionalities, making it a valuable resource for researchers and industry professionals alike.