AA12052
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 90% | in stock | $88.00 | $61.00 | - + | |
5mg | 90% | in stock | $220.00 | $154.00 | - + | |
25mg | 90% | in stock | $248.00 | $173.00 | - + | |
100mg | 90% | in stock | $376.00 | $263.00 | - + | |
250mg | 90% | in stock | $636.00 | $445.00 | - + | |
1g | 90% | in stock | $1,783.00 | $1,248.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA12052 |
Chemical Name: | 2H-1-BENZOPYRAN-3-ACETIC ACID, 7-AMINO-4-METHYL-2-OXO-, 2,5-DIOXO-1-PYRROLIDINYL ESTER |
CAS Number: | 113721-87-2 |
Molecular Formula: | C16H14N2O6 |
Molecular Weight: | 330.2921599999999 |
MDL Number: | MFCD00036170 |
SMILES: | O=C(Cc1c(=O)oc2c(c1C)ccc(c2)N)ON1C(=O)CCC1=O |
The compound 2,5-Dioxopyrrolidin-1-yl 2-(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)acetate is a versatile building block in chemical synthesis due to its unique structural features. It serves as an important intermediate in the creation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, this compound acts as a key component in the production of heterocyclic compounds and peptide derivatives. Its pyrrolidinone moiety enables it to participate in cyclization reactions, facilitating the formation of complex ring structures. Additionally, the chromenyl group enhances its reactivity towards nucleophiles, making it a valuable substrate for diversification through functional group transformations.Furthermore, the presence of an amino group in the chromenyl moiety offers the opportunity for further derivatization through amidation or condensation reactions, expanding the molecule's synthetic utility. Overall, 2,5-Dioxopyrrolidin-1-yl 2-(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)acetate plays a crucial role in constructing intricate molecular architectures with potential applications across various fields of chemistry.