logo
Home  > N-Desmethyl Olopatadine

AE14183

113835-92-0 | N-Desmethyl Olopatadine

Packsize Purity Availability Price Discounted Price    Quantity
2.5mg 3 weeks $414.00 $290.00 -   +
25mg 3 weeks $2,040.00 $1,428.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE14183
Chemical Name: N-Desmethyl Olopatadine
CAS Number: 113835-92-0
Molecular Formula: C20H21NO3
Molecular Weight: 323.3856
MDL Number: MFCD28898465
SMILES: CNCC/C=C/1c2cc(ccc2OCc2c1cccc2)CC(=O)O

 

Upstream Synthesis Route 
  • "N-Desmethyl Olopatadine is a versatile compound commonly used in chemical synthesis processes. This particular derivative serves as a key intermediate in the production of various pharmaceutical compounds, particularly in the development of antihistamine medications. Its unique molecular structure and reactivity make it a valuable building block for the synthesis of novel drug candidates. By incorporating N-Desmethyl Olopatadine into synthetic pathways, chemists can efficiently access structurally diverse molecules with potential therapeutic properties. This compound plays a crucial role in expanding the scope of chemical synthesis and drug development research."
FEATURED PRODUCTS