AE27928
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | 1 week | $475.00 | $333.00 | - + | |
5g | 98% | 1 week | $1,484.00 | $1,039.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE27928 |
Chemical Name: | Methyl (2s)-2-amino-3-(4-iodophenyl)propanoate |
CAS Number: | 113850-77-4 |
Molecular Formula: | C10H12INO2 |
Molecular Weight: | 305.1122 |
MDL Number: | MFCD08058398 |
SMILES: | COC(=O)[C@H](Cc1ccc(cc1)I)N |
Complexity: | 191 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.8 |
4-Iodo-L-phenylalanine methyl ester is a valuable building block in chemical synthesis, particularly in the field of organic chemistry. This compound is commonly used as a precursor in the preparation of various pharmaceuticals, fine chemicals, and advanced materials. With its unique structure and reactivity, 4-Iodo-L-phenylalanine methyl ester serves as a key intermediate in the synthesis of complex molecules with important biological activities. Its versatile nature allows for the introduction of specific functional groups, enabling chemists to tailor the properties of the final products for a wide range of applications. In addition, the iodo substituent in this compound provides a handle for further derivatization, opening up opportunities for the creation of novel molecular structures with enhanced properties. As such, 4-Iodo-L-phenylalanine methyl ester plays a crucial role in advancing the frontiers of chemical research and development, facilitating the exploration of new synthetic pathways and the discovery of innovative materials.