logo
Home  > {1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid

AA13406

114084-78-5 | {1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $122.00 $86.00 -   +
5g 95% in stock $418.00 $293.00 -   +
10g 95% in stock $713.00 $499.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA13406
Chemical Name: {1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid
CAS Number: 114084-78-5
Molecular Formula: C9H23NO7P2
Molecular Weight: 319.2289
MDL Number: MFCD00868772
SMILES: CCCCCN(CCC(P(=O)(O)O)(P(=O)(O)O)O)C

 

Computed Properties
Complexity: 342  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 19  
Hydrogen Bond Acceptor Count: 8  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 9  
XLogP3: -4.1  

 

 

Upstream Synthesis Route 
  • Ibandronate is a potent biphosphonate compound with important applications in chemical synthesis. This organic molecule plays a crucial role in the field of drug development and medicinal chemistry. Its unique structure and chemical properties make it a valuable reagent for the synthesis of various pharmaceutical compounds, particularly those targeted towards treating bone disorders such as osteoporosis.In chemical synthesis, Ibandronate serves as a versatile building block for creating complex molecular structures. Its phosphonate groups enable it to participate in a wide range of chemical reactions, including phosphorylation, alkylation, and condensation reactions. By strategically incorporating Ibandronate into synthetic pathways, chemists can efficiently construct new drug candidates with enhanced potency and selectivity.Furthermore, Ibandronate's ability to chelate metal ions makes it a valuable ligand in coordination chemistry. This attribute can be leveraged to design metal-based catalysts for various synthetic transformations, paving the way for greener and more sustainable chemical processes. Overall, the utilization of Ibandronate in chemical synthesis underscores its importance as a key player in pharmaceutical research and development.
Literature
FEATURED PRODUCTS