logo
Home  > Ethanone, 2-hydroxy-1,2-di-2-pyridinyl-

AA13500

1141-06-6 | Ethanone, 2-hydroxy-1,2-di-2-pyridinyl-

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $41.00 $29.00 -   +
5g 98% in stock $89.00 $62.00 -   +
25g 98% in stock $249.00 $175.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA13500
Chemical Name: Ethanone, 2-hydroxy-1,2-di-2-pyridinyl-
CAS Number: 1141-06-6
Molecular Formula: C12H10N2O2
Molecular Weight: 214.22
MDL Number: MFCD00010691
SMILES: OC(C(=O)c1ccccn1)c1ccccn1

 

Upstream Synthesis Route
  • Alpha-pyridoin, a versatile chemical compound, plays a crucial role in various chemical synthesis processes. This compound is highly valued for its application as a key building block in the creation of complex organic molecules. Its unique structure and reactivity make it an essential component in the formation of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, alpha-pyridoin serves as a valuable starting material for the synthesis of heterocyclic compounds, which are often found in a wide range of bioactive molecules. Its ability to participate in diverse synthetic transformations, such as condensation reactions, functionalization, and cross-coupling reactions, makes it a valuable tool for organic chemists seeking to access a wide array of chemical structures. Additionally, the presence of the pyridine ring in alpha-pyridoin provides opportunities for further diversification through various functional group modifications, offering flexibility in designing target molecules with specific properties. As a result, alpha-pyridoin stands as a fundamental component in modern chemical synthesis, facilitating the creation of novel compounds with potential applications in the pharmaceutical, agricultural, and materials industries.
FEATURED PRODUCTS